C27H51NO7 — CID 118168754
4-[3-(diethylamino)propoxycarbonyloxy]-11-octanoyloxyundecanoic acid (PubChem CID 118168754) has the molecular formula C27H51NO7 and a molecular weight of 501.71 g/mol. Its IUPAC name is 4-[3-(diethylamino)propoxycarbonyloxy]-11-octanoyloxyundecanoic acid.
| Compound Name | 4-[3-(diethylamino)propoxycarbonyloxy]-11-octanoyloxyundecanoic acid |
|---|---|
| PubChem CID | 118168754 |
| Molecular Formula | C27H51NO7 |
| Molecular Weight | 501.71 g/mol |
| Exact Mass | 501.37 |
| IUPAC Name | 4-[3-(diethylamino)propoxycarbonyloxy]-11-octanoyloxyundecanoic acid |
| SMILES | CCCCCCCC(=O)OCCCCCCCC(CCC(=O)O)OC(=O)OCCCN(CC)CC |
| InChI | InChI=1S/C27H51NO7/c1-4-7-8-10-14-18-26(31)33-22-15-12-9-11-13-17-24(19-20-25(29)30)35-27(32)34-23-16-21-28(5-2)6-3/h24H,4-23H2,1-3H3,(H,29,30) |
| InChIKey | HZDQJLBQSHBRFH-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 102.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.71 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|