C48H94N2O7 — CID 177370562
3-[2-(diethylamino)ethyl-[3-(1-heptoxy-1-oxododecan-6-yl)oxycarbonyloxypropyl]amino]propyl 2-heptylnonanoate (PubChem CID 177370562) has the molecular formula C48H94N2O7 and a molecular weight of 811.29 g/mol. Its IUPAC name is 3-[2-(diethylamino)ethyl-[3-(1-heptoxy-1-oxododecan-6-yl)oxycarbonyloxypropyl]amino]propyl 2-heptylnonanoate.
| Compound Name | 3-[2-(diethylamino)ethyl-[3-(1-heptoxy-1-oxododecan-6-yl)oxycarbonyloxypropyl]amino]propyl 2-heptylnonanoate |
|---|---|
| PubChem CID | 177370562 |
| Molecular Formula | C48H94N2O7 |
| Molecular Weight | 811.29 g/mol |
| Exact Mass | 810.71 |
| IUPAC Name | 3-[2-(diethylamino)ethyl-[3-(1-heptoxy-1-oxododecan-6-yl)oxycarbonyloxypropyl]amino]propyl 2-heptylnonanoate |
| SMILES | CCCCCCCOC(=O)CCCCC(CCCCCC)OC(=O)OCCCN(CCCOC(=O)C(CCCCCCC)CCCCCCC)CCN(CC)CC |
| InChI | InChI=1S/C48H94N2O7/c1-7-13-17-21-24-32-44(33-25-22-18-14-8-2)47(52)55-42-30-37-50(40-39-49(11-5)12-6)38-31-43-56-48(53)57-45(34-26-20-16-10-4)35-27-28-36-46(51)54-41-29-23-19-15-9-3/h44-45H,7-43H2,1-6H3 |
| InChIKey | MJJDVINVKFUUQL-UHFFFAOYSA-N |
| XLogP | 12.86 |
| TPSA | 94.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 43 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 811.29 |
| LogP ≤ 5 | 12.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|