C58H108N2O14 — CID 166099225
diheptyl 5-[2-[2-(diethylamino)ethyl-[2-(1,9-diheptoxy-1,9-dioxononan-5-yl)oxycarbonyloxyethyl]amino]ethoxycarbonyloxy]nonanedioate (PubChem CID 166099225) has the molecular formula C58H108N2O14 and a molecular weight of 1057.50 g/mol. Its IUPAC name is diheptyl 5-[2-[2-(diethylamino)ethyl-[2-(1,9-diheptoxy-1,9-dioxononan-5-yl)oxycarbonyloxyethyl]amino]ethoxycarbonyloxy]nonanedioate.
| Compound Name | diheptyl 5-[2-[2-(diethylamino)ethyl-[2-(1,9-diheptoxy-1,9-dioxononan-5-yl)oxycarbonyloxyethyl]amino]ethoxycarbonyloxy]nonanedioate |
|---|---|
| PubChem CID | 166099225 |
| Molecular Formula | C58H108N2O14 |
| Molecular Weight | 1057.50 g/mol |
| Exact Mass | 1056.78 |
| IUPAC Name | diheptyl 5-[2-[2-(diethylamino)ethyl-[2-(1,9-diheptoxy-1,9-dioxononan-5-yl)oxycarbonyloxyethyl]amino]ethoxycarbonyloxy]nonanedioate |
| SMILES | CCCCCCCOC(=O)CCCC(CCCC(=O)OCCCCCCC)OC(=O)OCCN(CCOC(=O)OC(CCCC(=O)OCCCCCCC)CCCC(=O)OCCCCCCC)CCN(CC)CC |
| InChI | InChI=1S/C58H108N2O14/c1-7-13-17-21-25-45-67-53(61)37-29-33-51(34-30-38-54(62)68-46-26-22-18-14-8-2)73-57(65)71-49-43-60(42-41-59(11-5)12-6)44-50-72-58(66)74-52(35-31-39-55(63)69-47-27-23-19-15-9-3)36-32-40-56(64)70-48-28-24-20-16-10-4/h51-52H,7-50H2,1-6H3 |
| InChIKey | UBEAUBLMCWGTRA-UHFFFAOYSA-N |
| XLogP | 13.41 |
| TPSA | 182.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 53 |
| Heavy Atoms | 74 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1057.50 |
| LogP ≤ 5 | 13.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|