C40H80N2O6 — CID 175420927
2-pentylheptyl 11-[2-[2-(diethylamino)ethyl-(2-hydroxyethyl)amino]ethoxycarbonyloxy]heptadecanoate (PubChem CID 175420927) has the molecular formula C40H80N2O6 and a molecular weight of 685.09 g/mol. Its IUPAC name is 2-pentylheptyl 11-[2-[2-(diethylamino)ethyl-(2-hydroxyethyl)amino]ethoxycarbonyloxy]heptadecanoate.
| Compound Name | 2-pentylheptyl 11-[2-[2-(diethylamino)ethyl-(2-hydroxyethyl)amino]ethoxycarbonyloxy]heptadecanoate |
|---|---|
| PubChem CID | 175420927 |
| Molecular Formula | C40H80N2O6 |
| Molecular Weight | 685.09 g/mol |
| Exact Mass | 684.60 |
| IUPAC Name | 2-pentylheptyl 11-[2-[2-(diethylamino)ethyl-(2-hydroxyethyl)amino]ethoxycarbonyloxy]heptadecanoate |
| SMILES | CCCCCCC(CCCCCCCCCC(=O)OCC(CCCCC)CCCCC)OC(=O)OCCN(CCO)CCN(CC)CC |
| InChI | InChI=1S/C40H80N2O6/c1-6-11-14-22-27-38(48-40(45)46-35-33-42(32-34-43)31-30-41(9-4)10-5)28-23-18-16-15-17-19-24-29-39(44)47-36-37(25-20-12-7-2)26-21-13-8-3/h37-38,43H,6-36H2,1-5H3 |
| InChIKey | CZBAXXNTFAFTBF-UHFFFAOYSA-N |
| XLogP | 9.95 |
| TPSA | 88.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 36 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 685.09 |
| LogP ≤ 5 | 9.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|