C26H52N2O6 — CID 174191624
10-[2-[2-(diethylamino)ethyl-(2-hydroxyethyl)amino]ethoxycarbonyloxy]pentadecanoic acid (PubChem CID 174191624) has the molecular formula C26H52N2O6 and a molecular weight of 488.71 g/mol. Its IUPAC name is 10-[2-[2-(diethylamino)ethyl-(2-hydroxyethyl)amino]ethoxycarbonyloxy]pentadecanoic acid.
| Compound Name | 10-[2-[2-(diethylamino)ethyl-(2-hydroxyethyl)amino]ethoxycarbonyloxy]pentadecanoic acid |
|---|---|
| PubChem CID | 174191624 |
| Molecular Formula | C26H52N2O6 |
| Molecular Weight | 488.71 g/mol |
| Exact Mass | 488.38 |
| IUPAC Name | 10-[2-[2-(diethylamino)ethyl-(2-hydroxyethyl)amino]ethoxycarbonyloxy]pentadecanoic acid |
| SMILES | CCCCCC(CCCCCCCCC(=O)O)OC(=O)OCCN(CCO)CCN(CC)CC |
| InChI | InChI=1S/C26H52N2O6/c1-4-7-12-15-24(16-13-10-8-9-11-14-17-25(30)31)34-26(32)33-23-21-28(20-22-29)19-18-27(5-2)6-3/h24,29H,4-23H2,1-3H3,(H,30,31) |
| InChIKey | GTSDUPUASPRLHM-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 99.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.71 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|