C76H148N2O10 — CID 166099240
2-hexyldecyl 10-[2-[2-(diethylamino)ethyl-[2-[16-(2-hexyldecoxy)-16-oxohexadecan-7-yl]oxycarbonyloxyethyl]amino]ethoxycarbonyloxy]hexadecanoate (PubChem CID 166099240) has the molecular formula C76H148N2O10 and a molecular weight of 1250.02 g/mol. Its IUPAC name is 2-hexyldecyl 10-[2-[2-(diethylamino)ethyl-[2-[16-(2-hexyldecoxy)-16-oxohexadecan-7-yl]oxycarbonyloxyethyl]amino]ethoxycarbonyloxy]hexadecanoate.
| Compound Name | 2-hexyldecyl 10-[2-[2-(diethylamino)ethyl-[2-[16-(2-hexyldecoxy)-16-oxohexadecan-7-yl]oxycarbonyloxyethyl]amino]ethoxycarbonyloxy]hexadecanoate |
|---|---|
| PubChem CID | 166099240 |
| Molecular Formula | C76H148N2O10 |
| Molecular Weight | 1250.02 g/mol |
| Exact Mass | 1249.11 |
| IUPAC Name | 2-hexyldecyl 10-[2-[2-(diethylamino)ethyl-[2-[16-(2-hexyldecoxy)-16-oxohexadecan-7-yl]oxycarbonyloxyethyl]amino]ethoxycarbonyloxy]hexadecanoate |
| SMILES | CCCCCCCCC(CCCCCC)COC(=O)CCCCCCCCC(CCCCCC)OC(=O)OCCN(CCOC(=O)OC(CCCCCC)CCCCCCCCC(=O)OCC(CCCCCC)CCCCCCCC)CCN(CC)CC |
| InChI | InChI=1S/C76H148N2O10/c1-9-17-23-29-35-43-53-69(51-41-25-19-11-3)67-85-73(79)59-49-39-33-31-37-47-57-71(55-45-27-21-13-5)87-75(81)83-65-63-78(62-61-77(15-7)16-8)64-66-84-76(82)88-72(56-46-28-22-14-6)58-48-38-32-34-40-50-60-74(80)86-68-70(52-42-26-20-12-4)54-44-36-30-24-18-10-2/h69-72H,9-68H2,1-8H3 |
| InChIKey | FWLBJZZWSOIYIL-UHFFFAOYSA-N |
| XLogP | 22.62 |
| TPSA | 130.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 69 |
| Heavy Atoms | 88 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1250.02 |
| LogP ≤ 5 | 22.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|