C56H108N2O7 — CID 153372673
2-[2-(diethylamino)ethyl-[2-[1-(2-hexyldecoxy)-1-oxoundecan-5-yl]oxycarbonyloxyethyl]amino]ethyl (Z)-octadec-9-enoate (PubChem CID 153372673) has the molecular formula C56H108N2O7 and a molecular weight of 921.49 g/mol. Its IUPAC name is 2-[2-(diethylamino)ethyl-[2-[1-(2-hexyldecoxy)-1-oxoundecan-5-yl]oxycarbonyloxyethyl]amino]ethyl (Z)-octadec-9-enoate.
| Compound Name | 2-[2-(diethylamino)ethyl-[2-[1-(2-hexyldecoxy)-1-oxoundecan-5-yl]oxycarbonyloxyethyl]amino]ethyl (Z)-octadec-9-enoate |
|---|---|
| PubChem CID | 153372673 |
| Molecular Formula | C56H108N2O7 |
| Molecular Weight | 921.49 g/mol |
| Exact Mass | 920.82 |
| IUPAC Name | 2-[2-(diethylamino)ethyl-[2-[1-(2-hexyldecoxy)-1-oxoundecan-5-yl]oxycarbonyloxyethyl]amino]ethyl (Z)-octadec-9-enoate |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)OCCN(CCOC(=O)OC(CCCCCC)CCCC(=O)OCC(CCCCCC)CCCCCCCC)CCN(CC)CC |
| InChI | InChI=1S/C56H108N2O7/c1-7-13-17-21-23-24-25-26-27-28-29-30-31-33-37-43-54(59)62-49-47-58(46-45-57(11-5)12-6)48-50-63-56(61)65-53(41-36-20-16-10-4)42-38-44-55(60)64-51-52(39-34-19-15-9-3)40-35-32-22-18-14-8-2/h26-27,52-53H,7-25,28-51H2,1-6H3/b27-26- |
| InChIKey | KEMLPFWGOZLTMH-RQZHXJHFSA-N |
| XLogP | 15.75 |
| TPSA | 94.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 50 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 921.49 |
| LogP ≤ 5 | 15.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|