C34H68N2O5 — CID 164717373
2-butyloctyl 6-[2-[2-(diethylamino)ethyl-propan-2-ylamino]ethoxycarbonyloxy]decanoate (PubChem CID 164717373) has the molecular formula C34H68N2O5 and a molecular weight of 584.93 g/mol. Its IUPAC name is 2-butyloctyl 6-[2-[2-(diethylamino)ethyl-propan-2-ylamino]ethoxycarbonyloxy]decanoate.
| Compound Name | 2-butyloctyl 6-[2-[2-(diethylamino)ethyl-propan-2-ylamino]ethoxycarbonyloxy]decanoate |
|---|---|
| PubChem CID | 164717373 |
| Molecular Formula | C34H68N2O5 |
| Molecular Weight | 584.93 g/mol |
| Exact Mass | 584.51 |
| IUPAC Name | 2-butyloctyl 6-[2-[2-(diethylamino)ethyl-propan-2-ylamino]ethoxycarbonyloxy]decanoate |
| SMILES | CCCCCCC(CCCC)COC(=O)CCCCC(CCCC)OC(=O)OCCN(CCN(CC)CC)C(C)C |
| InChI | InChI=1S/C34H68N2O5/c1-8-13-16-17-21-31(20-14-9-2)29-40-33(37)24-19-18-23-32(22-15-10-3)41-34(38)39-28-27-36(30(6)7)26-25-35(11-4)12-5/h30-32H,8-29H2,1-7H3 |
| InChIKey | IZEVDNXSAREEEE-UHFFFAOYSA-N |
| XLogP | 8.63 |
| TPSA | 68.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.93 |
| LogP ≤ 5 | 8.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|