C62H120N2O11 — CID 177165232
2-pentylheptyl 5-[3-[2-[ethyl(4-hydroxybutyl)amino]ethyl-[3-[1-oxo-1-(2-pentylheptoxy)undecan-5-yl]oxycarbonyloxypropyl]amino]propoxycarbonyloxy]undecanoate (PubChem CID 177165232) has the molecular formula C62H120N2O11 and a molecular weight of 1069.64 g/mol. Its IUPAC name is 2-pentylheptyl 5-[3-[2-[ethyl(4-hydroxybutyl)amino]ethyl-[3-[1-oxo-1-(2-pentylheptoxy)undecan-5-yl]oxycarbonyloxypropyl]amino]propoxycarbonyloxy]undecanoate.
| Compound Name | 2-pentylheptyl 5-[3-[2-[ethyl(4-hydroxybutyl)amino]ethyl-[3-[1-oxo-1-(2-pentylheptoxy)undecan-5-yl]oxycarbonyloxypropyl]amino]propoxycarbonyloxy]undecanoate |
|---|---|
| PubChem CID | 177165232 |
| Molecular Formula | C62H120N2O11 |
| Molecular Weight | 1069.64 g/mol |
| Exact Mass | 1068.89 |
| IUPAC Name | 2-pentylheptyl 5-[3-[2-[ethyl(4-hydroxybutyl)amino]ethyl-[3-[1-oxo-1-(2-pentylheptoxy)undecan-5-yl]oxycarbonyloxypropyl]amino]propoxycarbonyloxy]undecanoate |
| SMILES | CCCCCCC(CCCC(=O)OCC(CCCCC)CCCCC)OC(=O)OCCCN(CCCOC(=O)OC(CCCCCC)CCCC(=O)OCC(CCCCC)CCCCC)CCN(CC)CCCCO |
| InChI | InChI=1S/C62H120N2O11/c1-8-15-21-27-39-57(41-31-43-59(66)72-53-55(35-23-17-10-3)36-24-18-11-4)74-61(68)70-51-33-46-64(49-48-63(14-7)45-29-30-50-65)47-34-52-71-62(69)75-58(40-28-22-16-9-2)42-32-44-60(67)73-54-56(37-25-19-12-5)38-26-20-13-6/h55-58,65H,8-54H2,1-7H3 |
| InChIKey | ZCNNYXHHEJSADQ-UHFFFAOYSA-N |
| XLogP | 16.13 |
| TPSA | 150.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 56 |
| Heavy Atoms | 75 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1069.64 |
| LogP ≤ 5 | 16.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|