C34H67NO6 — CID 174317786
8-[6-heptadecan-9-yloxycarbonyloxyhexyl(2-hydroxyethyl)amino]octanoic acid (PubChem CID 174317786) has the molecular formula C34H67NO6 and a molecular weight of 585.91 g/mol. Its IUPAC name is 8-[6-heptadecan-9-yloxycarbonyloxyhexyl(2-hydroxyethyl)amino]octanoic acid.
| Compound Name | 8-[6-heptadecan-9-yloxycarbonyloxyhexyl(2-hydroxyethyl)amino]octanoic acid |
|---|---|
| PubChem CID | 174317786 |
| Molecular Formula | C34H67NO6 |
| Molecular Weight | 585.91 g/mol |
| Exact Mass | 585.50 |
| IUPAC Name | 8-[6-heptadecan-9-yloxycarbonyloxyhexyl(2-hydroxyethyl)amino]octanoic acid |
| SMILES | CCCCCCCCC(CCCCCCCC)OC(=O)OCCCCCCN(CCO)CCCCCCCC(=O)O |
| InChI | InChI=1S/C34H67NO6/c1-3-5-7-9-12-18-24-32(25-19-13-10-8-6-4-2)41-34(39)40-31-23-17-16-22-28-35(29-30-36)27-21-15-11-14-20-26-33(37)38/h32,36H,3-31H2,1-2H3,(H,37,38) |
| InChIKey | LTXQRWOZNNBXGC-UHFFFAOYSA-N |
| XLogP | 9.29 |
| TPSA | 96.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 32 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.91 |
| LogP ≤ 5 | 9.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|