C32H60N2O10 — CID 175997278
5-[2-[2-(1-carboxydecan-4-yloxycarbonyloxy)ethyl-[2-(dimethylamino)ethyl]amino]ethoxycarbonyloxy]undecanoic acid (PubChem CID 175997278) has the molecular formula C32H60N2O10 and a molecular weight of 632.84 g/mol. Its IUPAC name is 5-[2-[2-(1-carboxydecan-4-yloxycarbonyloxy)ethyl-[2-(dimethylamino)ethyl]amino]ethoxycarbonyloxy]undecanoic acid.
| Compound Name | 5-[2-[2-(1-carboxydecan-4-yloxycarbonyloxy)ethyl-[2-(dimethylamino)ethyl]amino]ethoxycarbonyloxy]undecanoic acid |
|---|---|
| PubChem CID | 175997278 |
| Molecular Formula | C32H60N2O10 |
| Molecular Weight | 632.84 g/mol |
| Exact Mass | 632.42 |
| IUPAC Name | 5-[2-[2-(1-carboxydecan-4-yloxycarbonyloxy)ethyl-[2-(dimethylamino)ethyl]amino]ethoxycarbonyloxy]undecanoic acid |
| SMILES | CCCCCCC(CCCC(=O)O)OC(=O)OCCN(CCOC(=O)OC(CCCCCC)CCCC(=O)O)CCN(C)C |
| InChI | InChI=1S/C32H60N2O10/c1-5-7-9-11-15-27(17-13-19-29(35)36)43-31(39)41-25-23-34(22-21-33(3)4)24-26-42-32(40)44-28(16-12-10-8-6-2)18-14-20-30(37)38/h27-28H,5-26H2,1-4H3,(H,35,36)(H,37,38) |
| InChIKey | ZHTPOTLFQDJFGX-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 152.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 29 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.84 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|