C61H105NO15 — CID 168955669
8-O-[2-[3-(diethylamino)propoxycarbonyloxymethyl]-3-[8-[(Z)-oct-5-enoxy]-8-oxooctanoyl]oxy-2-[[8-[(Z)-oct-5-enoxy]-8-oxooctanoyl]oxymethyl]propyl] 1-O-[(Z)-oct-5-enyl] octanedioate (PubChem CID 168955669) has the molecular formula C61H105NO15 and a molecular weight of 1092.50 g/mol. Its IUPAC name is 8-O-[2-[3-(diethylamino)propoxycarbonyloxymethyl]-3-[8-[(Z)-oct-5-enoxy]-8-oxooctanoyl]oxy-2-[[8-[(Z)-oct-5-enoxy]-8-oxooctanoyl]oxymethyl]propyl] 1-O-[(Z)-oct-5-enyl] octanedioate.
| Compound Name | 8-O-[2-[3-(diethylamino)propoxycarbonyloxymethyl]-3-[8-[(Z)-oct-5-enoxy]-8-oxooctanoyl]oxy-2-[[8-[(Z)-oct-5-enoxy]-8-oxooctanoyl]oxymethyl]propyl] 1-O-[(Z)-oct-5-enyl] octanedioate |
|---|---|
| PubChem CID | 168955669 |
| Molecular Formula | C61H105NO15 |
| Molecular Weight | 1092.50 g/mol |
| Exact Mass | 1091.75 |
| IUPAC Name | 8-O-[2-[3-(diethylamino)propoxycarbonyloxymethyl]-3-[8-[(Z)-oct-5-enoxy]-8-oxooctanoyl]oxy-2-[[8-[(Z)-oct-5-enoxy]-8-oxooctanoyl]oxymethyl]propyl] 1-O-[(Z)-oct-5-enyl] octanedioate |
| SMILES | CC/C=C\CCCCOC(=O)CCCCCCC(=O)OCC(COC(=O)CCCCCCC(=O)OCCCC/C=C\CC)(COC(=O)CCCCCCC(=O)OCCCC/C=C\CC)COC(=O)OCCCN(CC)CC |
| InChI | InChI=1S/C61H105NO15/c1-6-11-14-17-26-35-46-70-54(63)39-29-20-23-32-42-57(66)74-50-61(53-77-60(69)73-49-38-45-62(9-4)10-5,51-75-58(67)43-33-24-21-30-40-55(64)71-47-36-27-18-15-12-7-2)52-76-59(68)44-34-25-22-31-41-56(65)72-48-37-28-19-16-13-8-3/h11-16H,6-10,17-53H2,1-5H3/b14-11-,15-12-,16-13- |
| InChIKey | LDCBNCJMGBMXIM-KHFPHUMUSA-N |
| XLogP | 13.55 |
| TPSA | 196.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 53 |
| Heavy Atoms | 77 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1092.50 |
| LogP ≤ 5 | 13.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|