C51H91NO9 — CID 157217339
[2-[4,4-bis[(Z)-oct-5-enoxy]butanoyloxymethyl]-4-[3-(diethylamino)propoxycarbonyloxy]butyl] (9Z,12Z)-octadeca-9,12-dienoate (PubChem CID 157217339) has the molecular formula C51H91NO9 and a molecular weight of 862.29 g/mol. Its IUPAC name is [2-[4,4-bis[(Z)-oct-5-enoxy]butanoyloxymethyl]-4-[3-(diethylamino)propoxycarbonyloxy]butyl] (9Z,12Z)-octadeca-9,12-dienoate.
| Compound Name | [2-[4,4-bis[(Z)-oct-5-enoxy]butanoyloxymethyl]-4-[3-(diethylamino)propoxycarbonyloxy]butyl] (9Z,12Z)-octadeca-9,12-dienoate |
|---|---|
| PubChem CID | 157217339 |
| Molecular Formula | C51H91NO9 |
| Molecular Weight | 862.29 g/mol |
| Exact Mass | 861.67 |
| IUPAC Name | [2-[4,4-bis[(Z)-oct-5-enoxy]butanoyloxymethyl]-4-[3-(diethylamino)propoxycarbonyloxy]butyl] (9Z,12Z)-octadeca-9,12-dienoate |
| SMILES | CC/C=C\CCCCOC(CCC(=O)OCC(CCOC(=O)OCCCN(CC)CC)COC(=O)CCCCCCC/C=C\C/C=C\CCCCC)OCCCC/C=C\CC |
| InChI | InChI=1S/C51H91NO9/c1-6-11-14-17-20-21-22-23-24-25-26-27-28-29-32-36-48(53)60-45-47(39-44-59-51(55)58-43-35-40-52(9-4)10-5)46-61-49(54)37-38-50(56-41-33-30-18-15-12-7-2)57-42-34-31-19-16-13-8-3/h12-13,15-16,20-21,23-24,47,50H,6-11,14,17-19,22,25-46H2,1-5H3/b15-12-,16-13-,21-20-,24-23- |
| InChIKey | ASONOZYKCJLSHI-TXNUBTAQSA-N |
| XLogP | 13.19 |
| TPSA | 109.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 44 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 862.29 |
| LogP ≤ 5 | 13.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|