C49H91NO9 — CID 140926217
[2-(4,4-dioctoxybutanoyloxymethyl)-3-[3-[ethyl(methyl)amino]propoxycarbonyloxy]propyl] (9Z,12Z)-octadeca-9,12-dienoate (PubChem CID 140926217) has the molecular formula C49H91NO9 and a molecular weight of 838.26 g/mol. Its IUPAC name is [2-(4,4-dioctoxybutanoyloxymethyl)-3-[3-[ethyl(methyl)amino]propoxycarbonyloxy]propyl] (9Z,12Z)-octadeca-9,12-dienoate.
| Compound Name | [2-(4,4-dioctoxybutanoyloxymethyl)-3-[3-[ethyl(methyl)amino]propoxycarbonyloxy]propyl] (9Z,12Z)-octadeca-9,12-dienoate |
|---|---|
| PubChem CID | 140926217 |
| Molecular Formula | C49H91NO9 |
| Molecular Weight | 838.26 g/mol |
| Exact Mass | 837.67 |
| IUPAC Name | [2-(4,4-dioctoxybutanoyloxymethyl)-3-[3-[ethyl(methyl)amino]propoxycarbonyloxy]propyl] (9Z,12Z)-octadeca-9,12-dienoate |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCC(=O)OCC(COC(=O)CCC(OCCCCCCCC)OCCCCCCCC)COC(=O)OCCCN(C)CC |
| InChI | InChI=1S/C49H91NO9/c1-6-10-13-16-19-20-21-22-23-24-25-26-27-28-31-35-46(51)57-42-45(44-59-49(53)56-41-34-38-50(5)9-4)43-58-47(52)36-37-48(54-39-32-29-17-14-11-7-2)55-40-33-30-18-15-12-8-3/h19-20,22-23,45,48H,6-18,21,24-44H2,1-5H3/b20-19-,23-22- |
| InChIKey | QEDIVBLMRLFBLH-XUQDTYRNSA-N |
| XLogP | 12.86 |
| TPSA | 109.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 44 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 838.26 |
| LogP ≤ 5 | 12.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|