C46H85NO7 — CID 155245780
[2-[3-(diethylamino)propoxycarbonyloxymethyl]-3-(2-hexyldecanoyloxy)propyl] (9Z,12Z)-octadeca-9,12-dienoate (PubChem CID 155245780) has the molecular formula C46H85NO7 and a molecular weight of 764.19 g/mol. Its IUPAC name is [2-[3-(diethylamino)propoxycarbonyloxymethyl]-3-(2-hexyldecanoyloxy)propyl] (9Z,12Z)-octadeca-9,12-dienoate.
| Compound Name | [2-[3-(diethylamino)propoxycarbonyloxymethyl]-3-(2-hexyldecanoyloxy)propyl] (9Z,12Z)-octadeca-9,12-dienoate |
|---|---|
| PubChem CID | 155245780 |
| Molecular Formula | C46H85NO7 |
| Molecular Weight | 764.19 g/mol |
| Exact Mass | 763.63 |
| IUPAC Name | [2-[3-(diethylamino)propoxycarbonyloxymethyl]-3-(2-hexyldecanoyloxy)propyl] (9Z,12Z)-octadeca-9,12-dienoate |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCC(=O)OCC(COC(=O)OCCCN(CC)CC)COC(=O)C(CCCCCC)CCCCCCCC |
| InChI | InChI=1S/C46H85NO7/c1-6-11-14-17-19-20-21-22-23-24-25-26-27-29-32-36-44(48)52-39-42(41-54-46(50)51-38-33-37-47(9-4)10-5)40-53-45(49)43(34-30-16-13-8-3)35-31-28-18-15-12-7-2/h19-20,22-23,42-43H,6-18,21,24-41H2,1-5H3/b20-19-,23-22- |
| InChIKey | RWZCYUFLYWRUSU-XUQDTYRNSA-N |
| XLogP | 12.72 |
| TPSA | 91.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 39 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 764.19 |
| LogP ≤ 5 | 12.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|