C59H105NO9 — CID 146663734
[2-[4-[3-(diethylamino)propoxycarbonyloxy]dodecanoyloxy]-3-[(9Z,12Z)-octadeca-9,12-dienoyl]oxypropyl] (9Z,12Z)-octadeca-9,12-dienoate (PubChem CID 146663734) has the molecular formula C59H105NO9 and a molecular weight of 972.49 g/mol. Its IUPAC name is [2-[4-[3-(diethylamino)propoxycarbonyloxy]dodecanoyloxy]-3-[(9Z,12Z)-octadeca-9,12-dienoyl]oxypropyl] (9Z,12Z)-octadeca-9,12-dienoate.
| Compound Name | [2-[4-[3-(diethylamino)propoxycarbonyloxy]dodecanoyloxy]-3-[(9Z,12Z)-octadeca-9,12-dienoyl]oxypropyl] (9Z,12Z)-octadeca-9,12-dienoate |
|---|---|
| PubChem CID | 146663734 |
| Molecular Formula | C59H105NO9 |
| Molecular Weight | 972.49 g/mol |
| Exact Mass | 971.78 |
| IUPAC Name | [2-[4-[3-(diethylamino)propoxycarbonyloxy]dodecanoyloxy]-3-[(9Z,12Z)-octadeca-9,12-dienoyl]oxypropyl] (9Z,12Z)-octadeca-9,12-dienoate |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCC(=O)OCC(COC(=O)CCCCCCC/C=C\C/C=C\CCCCC)OC(=O)CCC(CCCCCCCC)OC(=O)OCCCN(CC)CC |
| InChI | InChI=1S/C59H105NO9/c1-6-11-14-17-20-22-24-26-28-30-32-34-36-39-42-46-56(61)66-52-55(53-67-57(62)47-43-40-37-35-33-31-29-27-25-23-21-18-15-12-7-2)68-58(63)49-48-54(45-41-38-19-16-13-8-3)69-59(64)65-51-44-50-60(9-4)10-5/h20-23,26-29,54-55H,6-19,24-25,30-53H2,1-5H3/b22-20-,23-21-,28-26-,29-27- |
| InChIKey | MXYUUVFSXRGHAX-RDHIOOFPSA-N |
| XLogP | 16.40 |
| TPSA | 117.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 50 |
| Heavy Atoms | 69 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 972.49 |
| LogP ≤ 5 | 16.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|