C49H89NO9 — CID 123740228
1,3-di(octanoyloxy)propan-2-yl 4-[3-(diethylamino)propoxycarbonyloxy]docosa-13,16-dienoate (PubChem CID 123740228) has the molecular formula C49H89NO9 and a molecular weight of 836.25 g/mol. Its IUPAC name is 1,3-di(octanoyloxy)propan-2-yl 4-[3-(diethylamino)propoxycarbonyloxy]docosa-13,16-dienoate.
| Compound Name | 1,3-di(octanoyloxy)propan-2-yl 4-[3-(diethylamino)propoxycarbonyloxy]docosa-13,16-dienoate |
|---|---|
| PubChem CID | 123740228 |
| Molecular Formula | C49H89NO9 |
| Molecular Weight | 836.25 g/mol |
| Exact Mass | 835.65 |
| IUPAC Name | 1,3-di(octanoyloxy)propan-2-yl 4-[3-(diethylamino)propoxycarbonyloxy]docosa-13,16-dienoate |
| SMILES | CCCCCC=CCC=CCCCCCCCCC(CCC(=O)OC(COC(=O)CCCCCCC)COC(=O)CCCCCCC)OC(=O)OCCCN(CC)CC |
| InChI | InChI=1S/C49H89NO9/c1-6-11-14-17-18-19-20-21-22-23-24-25-26-27-30-31-35-44(59-49(54)55-41-34-40-50(9-4)10-5)38-39-48(53)58-45(42-56-46(51)36-32-28-15-12-7-2)43-57-47(52)37-33-29-16-13-8-3/h18-19,21-22,44-45H,6-17,20,23-43H2,1-5H3 |
| InChIKey | OTPFIOFDUBPJPW-UHFFFAOYSA-N |
| XLogP | 12.94 |
| TPSA | 117.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 42 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 836.25 |
| LogP ≤ 5 | 12.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|