C48H87NO9 — CID 167133573
[2-[(14Z,17Z)-5-[3-(dimethylamino)propoxycarbonyloxy]-2-oxotricosa-14,17-dienoxy]-3-octanoyloxypropyl] octanoate (PubChem CID 167133573) has the molecular formula C48H87NO9 and a molecular weight of 822.22 g/mol. Its IUPAC name is [2-[(14Z,17Z)-5-[3-(dimethylamino)propoxycarbonyloxy]-2-oxotricosa-14,17-dienoxy]-3-octanoyloxypropyl] octanoate.
| Compound Name | [2-[(14Z,17Z)-5-[3-(dimethylamino)propoxycarbonyloxy]-2-oxotricosa-14,17-dienoxy]-3-octanoyloxypropyl] octanoate |
|---|---|
| PubChem CID | 167133573 |
| Molecular Formula | C48H87NO9 |
| Molecular Weight | 822.22 g/mol |
| Exact Mass | 821.64 |
| IUPAC Name | [2-[(14Z,17Z)-5-[3-(dimethylamino)propoxycarbonyloxy]-2-oxotricosa-14,17-dienoxy]-3-octanoyloxypropyl] octanoate |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCC(CCC(=O)COC(COC(=O)CCCCCCC)COC(=O)CCCCCCC)OC(=O)OCCCN(C)C |
| InChI | InChI=1S/C48H87NO9/c1-6-9-12-15-16-17-18-19-20-21-22-23-24-25-28-29-33-44(58-48(53)54-39-32-38-49(4)5)37-36-43(50)40-55-45(41-56-46(51)34-30-26-13-10-7-2)42-57-47(52)35-31-27-14-11-8-3/h16-17,19-20,44-45H,6-15,18,21-42H2,1-5H3/b17-16-,20-19- |
| InChIKey | PGOHOJVPAFYJAG-LTXDKZCQSA-N |
| XLogP | 12.21 |
| TPSA | 117.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 42 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 822.22 |
| LogP ≤ 5 | 12.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|