C35H67NO3 — CID 90466297
4-(dimethylamino)butyl [(19Z,22Z)-octacosa-19,22-dien-11-yl] carbonate (PubChem CID 90466297) has the molecular formula C35H67NO3 and a molecular weight of 549.93 g/mol. Its IUPAC name is 4-(dimethylamino)butyl [(19Z,22Z)-octacosa-19,22-dien-11-yl] carbonate.
| Compound Name | 4-(dimethylamino)butyl [(19Z,22Z)-octacosa-19,22-dien-11-yl] carbonate |
|---|---|
| PubChem CID | 90466297 |
| Molecular Formula | C35H67NO3 |
| Molecular Weight | 549.93 g/mol |
| Exact Mass | 549.51 |
| IUPAC Name | 4-(dimethylamino)butyl [(19Z,22Z)-octacosa-19,22-dien-11-yl] carbonate |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCC(CCCCCCCCCC)OC(=O)OCCCCN(C)C |
| InChI | InChI=1S/C35H67NO3/c1-5-7-9-11-13-15-16-17-18-19-20-21-23-25-27-31-34(30-26-24-22-14-12-10-8-6-2)39-35(37)38-33-29-28-32-36(3)4/h13,15,17-18,34H,5-12,14,16,19-33H2,1-4H3/b15-13-,18-17- |
| InChIKey | HSXPBHWYTRJISH-SAYPXFITSA-N |
| XLogP | 11.19 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 29 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.93 |
| LogP ≤ 5 | 11.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|