C51H96N2O2 — CID 54671209
[(6E,9E,30E,33E)-nonatriaconta-6,9,30,33-tetraen-20-yl] N-[3-(dimethylamino)propyl]-N-hexylcarbamate (PubChem CID 54671209) has the molecular formula C51H96N2O2 and a molecular weight of 769.34 g/mol. Its IUPAC name is [(6E,9E,30E,33E)-nonatriaconta-6,9,30,33-tetraen-20-yl] N-[3-(dimethylamino)propyl]-N-hexylcarbamate.
| Compound Name | [(6E,9E,30E,33E)-nonatriaconta-6,9,30,33-tetraen-20-yl] N-[3-(dimethylamino)propyl]-N-hexylcarbamate |
|---|---|
| PubChem CID | 54671209 |
| Molecular Formula | C51H96N2O2 |
| Molecular Weight | 769.34 g/mol |
| Exact Mass | 768.75 |
| IUPAC Name | [(6E,9E,30E,33E)-nonatriaconta-6,9,30,33-tetraen-20-yl] N-[3-(dimethylamino)propyl]-N-hexylcarbamate |
| SMILES | CCCCC/C=C/C/C=C/CCCCCCCCCC(CCCCCCCCC/C=C/C/C=C/CCCCC)OC(=O)N(CCCCCC)CCCN(C)C |
| InChI | InChI=1S/C51H96N2O2/c1-6-9-12-15-17-19-21-23-25-27-29-31-33-35-37-39-41-45-50(55-51(54)53(48-43-14-11-8-3)49-44-47-52(4)5)46-42-40-38-36-34-32-30-28-26-24-22-20-18-16-13-10-7-2/h17-20,23-26,50H,6-16,21-22,27-49H2,1-5H3/b19-17+,20-18+,25-23+,26-24+ |
| InChIKey | WYWNVVWTOHZXSS-CCXWHWJCSA-N |
| XLogP | 16.51 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 42 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 769.34 |
| LogP ≤ 5 | 16.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|