C76H144N2O2 — CID 158542361
(13Z,16Z)-N,N-dimethyl-3-nonyldocosa-13,16-dien-1-amine;[(6Z,9Z,28Z,31Z)-heptatriaconta-6,9,28,31-tetraen-19-yl] 4-(dimethylamino)butanoate (PubChem CID 158542361) has the molecular formula C76H144N2O2 and a molecular weight of 1118.00 g/mol. Its IUPAC name is (13Z,16Z)-N,N-dimethyl-3-nonyldocosa-13,16-dien-1-amine;[(6Z,9Z,28Z,31Z)-heptatriaconta-6,9,28,31-tetraen-19-yl] 4-(dimethylamino)butanoate.
| Compound Name | (13Z,16Z)-N,N-dimethyl-3-nonyldocosa-13,16-dien-1-amine;[(6Z,9Z,28Z,31Z)-heptatriaconta-6,9,28,31-tetraen-19-yl] 4-(dimethylamino)butanoate |
|---|---|
| PubChem CID | 158542361 |
| Molecular Formula | C76H144N2O2 |
| Molecular Weight | 1118.00 g/mol |
| Exact Mass | 1117.12 |
| IUPAC Name | (13Z,16Z)-N,N-dimethyl-3-nonyldocosa-13,16-dien-1-amine;[(6Z,9Z,28Z,31Z)-heptatriaconta-6,9,28,31-tetraen-19-yl] 4-(dimethylamino)butanoate |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCC(CCCCCCCC/C=C\C/C=C\CCCCC)OC(=O)CCCN(C)C.CCCCC/C=C\C/C=C\CCCCCCCCCC(CCCCCCCCC)CCN(C)C |
| InChI | InChI=1S/C43H79NO2.C33H65N/c1-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-35-38-42(46-43(45)40-37-41-44(3)4)39-36-34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-2;1-5-7-9-11-13-14-15-16-17-18-19-20-21-22-24-26-28-30-33(31-32-34(3)4)29-27-25-23-12-10-8-6-2/h13-16,19-22,42H,5-12,17-18,23-41H2,1-4H3;13-14,16-17,33H,5-12,15,18-32H2,1-4H3/b15-13-,16-14-,21-19-,22-20-;14-13-,17-16- |
| InChIKey | HORLHSYTKUGTKD-ASJXJJAJSA-N |
| XLogP | 24.94 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 62 |
| Heavy Atoms | 80 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1118.00 |
| LogP ≤ 5 | 24.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|