C51H95NO6 — CID 123442010
1,7-bis(octadeca-9,12-dienoxymethoxy)heptan-4-yl 4-(dimethylamino)butanoate (PubChem CID 123442010) has the molecular formula C51H95NO6 and a molecular weight of 818.32 g/mol. Its IUPAC name is 1,7-bis(octadeca-9,12-dienoxymethoxy)heptan-4-yl 4-(dimethylamino)butanoate.
| Compound Name | 1,7-bis(octadeca-9,12-dienoxymethoxy)heptan-4-yl 4-(dimethylamino)butanoate |
|---|---|
| PubChem CID | 123442010 |
| Molecular Formula | C51H95NO6 |
| Molecular Weight | 818.32 g/mol |
| Exact Mass | 817.72 |
| IUPAC Name | 1,7-bis(octadeca-9,12-dienoxymethoxy)heptan-4-yl 4-(dimethylamino)butanoate |
| SMILES | CCCCCC=CCC=CCCCCCCCCOCOCCCC(CCCOCOCCCCCCCCC=CCC=CCCCCC)OC(=O)CCCN(C)C |
| InChI | InChI=1S/C51H95NO6/c1-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-35-44-54-48-56-46-38-40-50(58-51(53)42-37-43-52(3)4)41-39-47-57-49-55-45-36-34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-2/h13-16,19-22,50H,5-12,17-18,23-49H2,1-4H3 |
| InChIKey | BYODWJCZXYZIFR-UHFFFAOYSA-N |
| XLogP | 14.41 |
| TPSA | 66.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 47 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 818.32 |
| LogP ≤ 5 | 14.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|