C52H97NO4 — CID 178067435
[(17Z,20Z)-8-[4-(dimethylamino)butanoyloxy]hexacosa-17,20-dienyl] (E)-3-heptyltridec-2-enoate (PubChem CID 178067435) has the molecular formula C52H97NO4 and a molecular weight of 800.35 g/mol. Its IUPAC name is [(17Z,20Z)-8-[4-(dimethylamino)butanoyloxy]hexacosa-17,20-dienyl] (E)-3-heptyltridec-2-enoate.
| Compound Name | [(17Z,20Z)-8-[4-(dimethylamino)butanoyloxy]hexacosa-17,20-dienyl] (E)-3-heptyltridec-2-enoate |
|---|---|
| PubChem CID | 178067435 |
| Molecular Formula | C52H97NO4 |
| Molecular Weight | 800.35 g/mol |
| Exact Mass | 799.74 |
| IUPAC Name | [(17Z,20Z)-8-[4-(dimethylamino)butanoyloxy]hexacosa-17,20-dienyl] (E)-3-heptyltridec-2-enoate |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCC(CCCCCCCOC(=O)/C=C(\CCCCCCC)CCCCCCCCCC)OC(=O)CCCN(C)C |
| InChI | InChI=1S/C52H97NO4/c1-6-9-12-15-17-19-20-21-22-23-24-25-26-28-32-37-43-50(57-51(54)45-40-46-53(4)5)44-38-33-29-34-39-47-56-52(55)48-49(41-35-30-14-11-8-3)42-36-31-27-18-16-13-10-7-2/h17,19,21-22,48,50H,6-16,18,20,23-47H2,1-5H3/b19-17-,22-21-,49-48+ |
| InChIKey | XGYWWACCVBNIFQ-MKVGOSFISA-N |
| XLogP | 16.15 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 44 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 800.35 |
| LogP ≤ 5 | 16.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|