C52H95NO8 — CID 175901714
9-O-[2-[4-(dimethylamino)butanoyloxy]-3-[(9E,12E)-octadeca-9,12-dienoyl]oxypropyl] 1-O-(2-hexyldecyl) nonanedioate (PubChem CID 175901714) has the molecular formula C52H95NO8 and a molecular weight of 862.33 g/mol. Its IUPAC name is 9-O-[2-[4-(dimethylamino)butanoyloxy]-3-[(9E,12E)-octadeca-9,12-dienoyl]oxypropyl] 1-O-(2-hexyldecyl) nonanedioate.
| Compound Name | 9-O-[2-[4-(dimethylamino)butanoyloxy]-3-[(9E,12E)-octadeca-9,12-dienoyl]oxypropyl] 1-O-(2-hexyldecyl) nonanedioate |
|---|---|
| PubChem CID | 175901714 |
| Molecular Formula | C52H95NO8 |
| Molecular Weight | 862.33 g/mol |
| Exact Mass | 861.71 |
| IUPAC Name | 9-O-[2-[4-(dimethylamino)butanoyloxy]-3-[(9E,12E)-octadeca-9,12-dienoyl]oxypropyl] 1-O-(2-hexyldecyl) nonanedioate |
| SMILES | CCCCC/C=C/C/C=C/CCCCCCCC(=O)OCC(COC(=O)CCCCCCCC(=O)OCC(CCCCCC)CCCCCCCC)OC(=O)CCCN(C)C |
| InChI | InChI=1S/C52H95NO8/c1-6-9-12-15-17-18-19-20-21-22-23-24-25-28-33-40-50(55)59-45-48(61-52(57)42-36-43-53(4)5)46-60-51(56)41-35-30-26-29-34-39-49(54)58-44-47(37-31-14-11-8-3)38-32-27-16-13-10-7-2/h17-18,20-21,47-48H,6-16,19,22-46H2,1-5H3/b18-17+,21-20+ |
| InChIKey | OPKSBPXBGTVMON-MAGUTPBXSA-N |
| XLogP | 13.75 |
| TPSA | 108.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 45 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 862.33 |
| LogP ≤ 5 | 13.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|