C41H71NO6 — CID 164815641
[(2R)-3-[4-(dimethylamino)butanoyloxy]-2-[(9Z,12Z)-hexadeca-9,12-dienoyl]oxypropyl] (9Z,12Z)-hexadeca-9,12-dienoate (PubChem CID 164815641) has the molecular formula C41H71NO6 and a molecular weight of 674.02 g/mol. Its IUPAC name is [(2R)-3-[4-(dimethylamino)butanoyloxy]-2-[(9Z,12Z)-hexadeca-9,12-dienoyl]oxypropyl] (9Z,12Z)-hexadeca-9,12-dienoate.
| Compound Name | [(2R)-3-[4-(dimethylamino)butanoyloxy]-2-[(9Z,12Z)-hexadeca-9,12-dienoyl]oxypropyl] (9Z,12Z)-hexadeca-9,12-dienoate |
|---|---|
| PubChem CID | 164815641 |
| Molecular Formula | C41H71NO6 |
| Molecular Weight | 674.02 g/mol |
| Exact Mass | 673.53 |
| IUPAC Name | [(2R)-3-[4-(dimethylamino)butanoyloxy]-2-[(9Z,12Z)-hexadeca-9,12-dienoyl]oxypropyl] (9Z,12Z)-hexadeca-9,12-dienoate |
| SMILES | CCC/C=C\C/C=C\CCCCCCCC(=O)OC[C@H](COC(=O)CCCN(C)C)OC(=O)CCCCCCC/C=C\C/C=C\CCC |
| InChI | InChI=1S/C41H71NO6/c1-5-7-9-11-13-15-17-19-21-23-25-27-29-32-39(43)46-36-38(37-47-40(44)34-31-35-42(3)4)48-41(45)33-30-28-26-24-22-20-18-16-14-12-10-8-6-2/h9-12,15-18,38H,5-8,13-14,19-37H2,1-4H3/b11-9-,12-10-,17-15-,18-16-/t38-/m1/s1 |
| InChIKey | LUYPODZZGULEQZ-CNQBSTPUSA-N |
| XLogP | 10.39 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 33 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.02 |
| LogP ≤ 5 | 10.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|