C43H80N2O2 — CID 54674626
[(5E,8E,26E,29E)-pentatriaconta-5,8,26,29-tetraen-18-yl] N-[3-[ethyl(methyl)amino]propyl]-N-methylcarbamate (PubChem CID 54674626) has the molecular formula C43H80N2O2 and a molecular weight of 657.12 g/mol. Its IUPAC name is [(5E,8E,26E,29E)-pentatriaconta-5,8,26,29-tetraen-18-yl] N-[3-[ethyl(methyl)amino]propyl]-N-methylcarbamate.
| Compound Name | [(5E,8E,26E,29E)-pentatriaconta-5,8,26,29-tetraen-18-yl] N-[3-[ethyl(methyl)amino]propyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 54674626 |
| Molecular Formula | C43H80N2O2 |
| Molecular Weight | 657.12 g/mol |
| Exact Mass | 656.62 |
| IUPAC Name | [(5E,8E,26E,29E)-pentatriaconta-5,8,26,29-tetraen-18-yl] N-[3-[ethyl(methyl)amino]propyl]-N-methylcarbamate |
| SMILES | CCCC/C=C/C/C=C/CCCCCCCCC(CCCCCCC/C=C/C/C=C/CCCCC)OC(=O)N(C)CCCN(C)CC |
| InChI | InChI=1S/C43H80N2O2/c1-6-9-11-13-15-17-19-21-23-25-27-29-31-33-35-38-42(47-43(46)45(5)41-37-40-44(4)8-3)39-36-34-32-30-28-26-24-22-20-18-16-14-12-10-7-2/h13,15-16,18-19,21-22,24,42H,6-12,14,17,20,23,25-41H2,1-5H3/b15-13+,18-16+,21-19+,24-22+ |
| InChIKey | WSNNFORMXPPTSY-ROFKJJNLSA-N |
| XLogP | 13.39 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 34 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.12 |
| LogP ≤ 5 | 13.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|