C36H66O4 — CID 138130472
9-[(9Z,12Z)-heptadeca-9,12-dienoyl]oxynonadecanoic acid (PubChem CID 138130472) has the molecular formula C36H66O4 and a molecular weight of 562.92 g/mol. Its IUPAC name is 9-[(9Z,12Z)-heptadeca-9,12-dienoyl]oxynonadecanoic acid.
| Compound Name | 9-[(9Z,12Z)-heptadeca-9,12-dienoyl]oxynonadecanoic acid |
|---|---|
| PubChem CID | 138130472 |
| Molecular Formula | C36H66O4 |
| Molecular Weight | 562.92 g/mol |
| Exact Mass | 562.50 |
| IUPAC Name | 9-[(9Z,12Z)-heptadeca-9,12-dienoyl]oxynonadecanoic acid |
| SMILES | CCCC/C=C\C/C=C\CCCCCCCC(=O)OC(CCCCCCCCCC)CCCCCCCC(=O)O |
| InChI | InChI=1S/C36H66O4/c1-3-5-7-9-11-13-14-15-16-17-18-20-25-29-33-36(39)40-34(30-26-22-19-12-10-8-6-4-2)31-27-23-21-24-28-32-35(37)38/h9,11,14-15,34H,3-8,10,12-13,16-33H2,1-2H3,(H,37,38)/b11-9-,15-14- |
| InChIKey | BTSZTDDEMNTZFL-BXPCSNPTSA-N |
| XLogP | 11.67 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 31 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.92 |
| LogP ≤ 5 | 11.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|