C40H74N2O2 — CID 88891080
[(2Z,5Z,24Z,27Z)-tritriaconta-2,5,24,27-tetraen-14-yl] N-[2-(dimethylamino)ethyl]-N-ethylcarbamate (PubChem CID 88891080) has the molecular formula C40H74N2O2 and a molecular weight of 615.04 g/mol. Its IUPAC name is [(2Z,5Z,24Z,27Z)-tritriaconta-2,5,24,27-tetraen-14-yl] N-[2-(dimethylamino)ethyl]-N-ethylcarbamate.
| Compound Name | [(2Z,5Z,24Z,27Z)-tritriaconta-2,5,24,27-tetraen-14-yl] N-[2-(dimethylamino)ethyl]-N-ethylcarbamate |
|---|---|
| PubChem CID | 88891080 |
| Molecular Formula | C40H74N2O2 |
| Molecular Weight | 615.04 g/mol |
| Exact Mass | 614.58 |
| IUPAC Name | [(2Z,5Z,24Z,27Z)-tritriaconta-2,5,24,27-tetraen-14-yl] N-[2-(dimethylamino)ethyl]-N-ethylcarbamate |
| SMILES | C/C=C\C/C=C\CCCCCCCC(CCCCCCCCC/C=C\C/C=C\CCCCC)OC(=O)N(CC)CCN(C)C |
| InChI | InChI=1S/C40H74N2O2/c1-6-9-11-13-15-17-19-20-21-22-23-24-26-28-30-32-34-36-39(44-40(43)42(8-3)38-37-41(4)5)35-33-31-29-27-25-18-16-14-12-10-7-2/h7,10,14-17,20-21,39H,6,8-9,11-13,18-19,22-38H2,1-5H3/b10-7-,16-14-,17-15-,21-20- |
| InChIKey | BKUXARXTKZKNGM-COZWFQAFSA-N |
| XLogP | 12.22 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 31 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.04 |
| LogP ≤ 5 | 12.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|