C46H85NO2 — CID 76830312
heptatriaconta-6,9,28,31-tetraen-19-yl 4-[ethyl(propan-2-yl)amino]butanoate (PubChem CID 76830312) has the molecular formula C46H85NO2 and a molecular weight of 684.19 g/mol. Its IUPAC name is heptatriaconta-6,9,28,31-tetraen-19-yl 4-[ethyl(propan-2-yl)amino]butanoate.
| Compound Name | heptatriaconta-6,9,28,31-tetraen-19-yl 4-[ethyl(propan-2-yl)amino]butanoate |
|---|---|
| PubChem CID | 76830312 |
| Molecular Formula | C46H85NO2 |
| Molecular Weight | 684.19 g/mol |
| Exact Mass | 683.66 |
| IUPAC Name | heptatriaconta-6,9,28,31-tetraen-19-yl 4-[ethyl(propan-2-yl)amino]butanoate |
| SMILES | CCCCCC=CCC=CCCCCCCCCC(CCCCCCCCC=CCC=CCCCCC)OC(=O)CCCN(CC)C(C)C |
| InChI | InChI=1S/C46H85NO2/c1-6-9-11-13-15-17-19-21-23-25-27-29-31-33-35-37-40-45(49-46(48)42-39-43-47(8-3)44(4)5)41-38-36-34-32-30-28-26-24-22-20-18-16-14-12-10-7-2/h15-18,21-24,44-45H,6-14,19-20,25-43H2,1-5H3 |
| InChIKey | GPWDVOFFRHOYQA-UHFFFAOYSA-N |
| XLogP | 14.82 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 37 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 684.19 |
| LogP ≤ 5 | 14.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|