C29H55NO3 — CID 175912089
3-(diethylamino)propyl [(12Z,15Z)-henicosa-12,15-dien-3-yl] carbonate (PubChem CID 175912089) has the molecular formula C29H55NO3 and a molecular weight of 465.76 g/mol. Its IUPAC name is 3-(diethylamino)propyl [(12Z,15Z)-henicosa-12,15-dien-3-yl] carbonate.
| Compound Name | 3-(diethylamino)propyl [(12Z,15Z)-henicosa-12,15-dien-3-yl] carbonate |
|---|---|
| PubChem CID | 175912089 |
| Molecular Formula | C29H55NO3 |
| Molecular Weight | 465.76 g/mol |
| Exact Mass | 465.42 |
| IUPAC Name | 3-(diethylamino)propyl [(12Z,15Z)-henicosa-12,15-dien-3-yl] carbonate |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCC(CC)OC(=O)OCCCN(CC)CC |
| InChI | InChI=1S/C29H55NO3/c1-5-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-25-28(6-2)33-29(31)32-27-24-26-30(7-3)8-4/h12-13,15-16,28H,5-11,14,17-27H2,1-4H3/b13-12-,16-15- |
| InChIKey | SHHBUUIQIJCOPO-QGLGPCELSA-N |
| XLogP | 8.85 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.76 |
| LogP ≤ 5 | 8.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|