C56H104N2O9 — CID 162764423
heptadecan-9-yl 4-[[2-[3-(diethylamino)propoxycarbonyloxymethyl]-3-[(9Z,12Z)-octadeca-9,12-dienoxy]carbonyloxypropyl]amino]-2,2,3,3-tetramethyl-4-oxobutanoate (PubChem CID 162764423) has the molecular formula C56H104N2O9 and a molecular weight of 949.45 g/mol. Its IUPAC name is heptadecan-9-yl 4-[[2-[3-(diethylamino)propoxycarbonyloxymethyl]-3-[(9Z,12Z)-octadeca-9,12-dienoxy]carbonyloxypropyl]amino]-2,2,3,3-tetramethyl-4-oxobutanoate.
| Compound Name | heptadecan-9-yl 4-[[2-[3-(diethylamino)propoxycarbonyloxymethyl]-3-[(9Z,12Z)-octadeca-9,12-dienoxy]carbonyloxypropyl]amino]-2,2,3,3-tetramethyl-4-oxobutanoate |
|---|---|
| PubChem CID | 162764423 |
| Molecular Formula | C56H104N2O9 |
| Molecular Weight | 949.45 g/mol |
| Exact Mass | 948.77 |
| IUPAC Name | heptadecan-9-yl 4-[[2-[3-(diethylamino)propoxycarbonyloxymethyl]-3-[(9Z,12Z)-octadeca-9,12-dienoxy]carbonyloxypropyl]amino]-2,2,3,3-tetramethyl-4-oxobutanoate |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCOC(=O)OCC(CNC(=O)C(C)(C)C(C)(C)C(=O)OC(CCCCCCCC)CCCCCCCC)COC(=O)OCCCN(CC)CC |
| InChI | InChI=1S/C56H104N2O9/c1-10-15-18-21-24-25-26-27-28-29-30-31-32-33-36-39-44-63-53(61)65-47-49(48-66-54(62)64-45-40-43-58(13-4)14-5)46-57-51(59)55(6,7)56(8,9)52(60)67-50(41-37-34-22-19-16-11-2)42-38-35-23-20-17-12-3/h24-25,27-28,49-50H,10-23,26,29-48H2,1-9H3,(H,57,59)/b25-24-,28-27- |
| InChIKey | GDPXBRUHZUAETM-WGSVINMHSA-N |
| XLogP | 15.04 |
| TPSA | 129.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 45 |
| Heavy Atoms | 67 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 949.45 |
| LogP ≤ 5 | 15.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|