C49H91NO7 — CID 146276387
(9Z,12Z)-2-[2-[3-(diethylamino)propoxycarbonyloxymethyl]-3-(3-octylundecanoyloxy)propyl]octadeca-9,12-dienoic acid (PubChem CID 146276387) has the molecular formula C49H91NO7 and a molecular weight of 806.27 g/mol. Its IUPAC name is (9Z,12Z)-2-[2-[3-(diethylamino)propoxycarbonyloxymethyl]-3-(3-octylundecanoyloxy)propyl]octadeca-9,12-dienoic acid.
| Compound Name | (9Z,12Z)-2-[2-[3-(diethylamino)propoxycarbonyloxymethyl]-3-(3-octylundecanoyloxy)propyl]octadeca-9,12-dienoic acid |
|---|---|
| PubChem CID | 146276387 |
| Molecular Formula | C49H91NO7 |
| Molecular Weight | 806.27 g/mol |
| Exact Mass | 805.68 |
| IUPAC Name | (9Z,12Z)-2-[2-[3-(diethylamino)propoxycarbonyloxymethyl]-3-(3-octylundecanoyloxy)propyl]octadeca-9,12-dienoic acid |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCC(CC(COC(=O)CC(CCCCCCCC)CCCCCCCC)COC(=O)OCCCN(CC)CC)C(=O)O |
| InChI | InChI=1S/C49H91NO7/c1-6-11-14-17-20-21-22-23-24-25-26-27-30-33-37-46(48(52)53)40-45(43-57-49(54)55-39-34-38-50(9-4)10-5)42-56-47(51)41-44(35-31-28-18-15-12-7-2)36-32-29-19-16-13-8-3/h20-21,23-24,44-46H,6-19,22,25-43H2,1-5H3,(H,52,53)/b21-20-,24-23- |
| InChIKey | ATMOWZUOJXWUOL-IFLFXUNCSA-N |
| XLogP | 14.05 |
| TPSA | 102.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 42 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 806.27 |
| LogP ≤ 5 | 14.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|