C46H85NO11 — CID 166501499
1-O-[2-[3-(diethylamino)propoxycarbonyloxymethyl]-3-(4,4-dioctoxybutanoyloxy)propyl] 7-O-[(Z)-hept-1-enyl] heptanedioate (PubChem CID 166501499) has the molecular formula C46H85NO11 and a molecular weight of 828.18 g/mol. Its IUPAC name is 1-O-[2-[3-(diethylamino)propoxycarbonyloxymethyl]-3-(4,4-dioctoxybutanoyloxy)propyl] 7-O-[(Z)-hept-1-enyl] heptanedioate.
| Compound Name | 1-O-[2-[3-(diethylamino)propoxycarbonyloxymethyl]-3-(4,4-dioctoxybutanoyloxy)propyl] 7-O-[(Z)-hept-1-enyl] heptanedioate |
|---|---|
| PubChem CID | 166501499 |
| Molecular Formula | C46H85NO11 |
| Molecular Weight | 828.18 g/mol |
| Exact Mass | 827.61 |
| IUPAC Name | 1-O-[2-[3-(diethylamino)propoxycarbonyloxymethyl]-3-(4,4-dioctoxybutanoyloxy)propyl] 7-O-[(Z)-hept-1-enyl] heptanedioate |
| SMILES | CCCCC/C=C\OC(=O)CCCCCC(=O)OCC(COC(=O)CCC(OCCCCCCCC)OCCCCCCCC)COC(=O)OCCCN(CC)CC |
| InChI | InChI=1S/C46H85NO11/c1-6-11-14-17-20-26-35-53-45(54-36-27-21-18-15-12-7-2)32-31-44(50)57-39-41(40-58-46(51)55-37-28-33-47(9-4)10-5)38-56-43(49)30-24-22-23-29-42(48)52-34-25-19-16-13-8-3/h25,34,41,45H,6-24,26-33,35-40H2,1-5H3/b34-25- |
| InChIKey | MKHYEEAVNYEXJV-NQUVTRGKSA-N |
| XLogP | 11.02 |
| TPSA | 136.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 42 |
| Heavy Atoms | 58 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 828.18 |
| LogP ≤ 5 | 11.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|