C55H95NO9 — CID 164591317
[3-[3-(diethylamino)propoxycarbonyloxymethyl]-5-(4,4-dioctoxybutanoyloxymethyl)phenyl]methyl (9Z,12Z)-octadeca-9,12-dienoate (PubChem CID 164591317) has the molecular formula C55H95NO9 and a molecular weight of 914.36 g/mol. Its IUPAC name is [3-[3-(diethylamino)propoxycarbonyloxymethyl]-5-(4,4-dioctoxybutanoyloxymethyl)phenyl]methyl (9Z,12Z)-octadeca-9,12-dienoate.
| Compound Name | [3-[3-(diethylamino)propoxycarbonyloxymethyl]-5-(4,4-dioctoxybutanoyloxymethyl)phenyl]methyl (9Z,12Z)-octadeca-9,12-dienoate |
|---|---|
| PubChem CID | 164591317 |
| Molecular Formula | C55H95NO9 |
| Molecular Weight | 914.36 g/mol |
| Exact Mass | 913.70 |
| IUPAC Name | [3-[3-(diethylamino)propoxycarbonyloxymethyl]-5-(4,4-dioctoxybutanoyloxymethyl)phenyl]methyl (9Z,12Z)-octadeca-9,12-dienoate |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCC(=O)OCc1cc(COC(=O)CCC(OCCCCCCCC)OCCCCCCCC)cc(COC(=O)OCCCN(CC)CC)c1 |
| InChI | InChI=1S/C55H95NO9/c1-6-11-14-17-20-21-22-23-24-25-26-27-28-29-32-36-52(57)63-46-49-43-50(45-51(44-49)48-65-55(59)62-42-35-39-56(9-4)10-5)47-64-53(58)37-38-54(60-40-33-30-18-15-12-7-2)61-41-34-31-19-16-13-8-3/h20-21,23-24,43-45,54H,6-19,22,25-42,46-48H2,1-5H3/b21-20-,24-23- |
| InChIKey | WAXHVZIZMJSYAF-IFLFXUNCSA-N |
| XLogP | 14.83 |
| TPSA | 109.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 45 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 914.36 |
| LogP ≤ 5 | 14.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|