C48H89NO9 — CID 177207991
[4-[3-(dimethylamino)propoxycarbonyloxy]-4-(4,4-dioctoxybutanoyloxy)butyl] (9Z,12Z)-octadeca-9,12-dienoate (PubChem CID 177207991) has the molecular formula C48H89NO9 and a molecular weight of 824.24 g/mol. Its IUPAC name is [4-[3-(dimethylamino)propoxycarbonyloxy]-4-(4,4-dioctoxybutanoyloxy)butyl] (9Z,12Z)-octadeca-9,12-dienoate.
| Compound Name | [4-[3-(dimethylamino)propoxycarbonyloxy]-4-(4,4-dioctoxybutanoyloxy)butyl] (9Z,12Z)-octadeca-9,12-dienoate |
|---|---|
| PubChem CID | 177207991 |
| Molecular Formula | C48H89NO9 |
| Molecular Weight | 824.24 g/mol |
| Exact Mass | 823.65 |
| IUPAC Name | [4-[3-(dimethylamino)propoxycarbonyloxy]-4-(4,4-dioctoxybutanoyloxy)butyl] (9Z,12Z)-octadeca-9,12-dienoate |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCC(=O)OCCCC(OC(=O)CCC(OCCCCCCCC)OCCCCCCCC)OC(=O)OCCCN(C)C |
| InChI | InChI=1S/C48H89NO9/c1-6-9-12-15-18-19-20-21-22-23-24-25-26-27-30-35-44(50)53-42-33-36-47(58-48(52)56-43-34-39-49(4)5)57-45(51)37-38-46(54-40-31-28-16-13-10-7-2)55-41-32-29-17-14-11-8-3/h18-19,21-22,46-47H,6-17,20,23-43H2,1-5H3/b19-18-,22-21- |
| InChIKey | PBVZIXOAEZWIOF-VYEFPUSRSA-N |
| XLogP | 12.96 |
| TPSA | 109.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 43 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 824.24 |
| LogP ≤ 5 | 12.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|