C73H144O6 — CID 158773446
9,9-dimethyldecyl decanoate;6,6-dimethylheptyl 4,4-dioctoxybutanoate;(6Z,9Z)-19,19-dimethylicosa-6,9-diene (PubChem CID 158773446) has the molecular formula C73H144O6 and a molecular weight of 1117.95 g/mol. Its IUPAC name is 9,9-dimethyldecyl decanoate;6,6-dimethylheptyl 4,4-dioctoxybutanoate;(6Z,9Z)-19,19-dimethylicosa-6,9-diene.
| Compound Name | 9,9-dimethyldecyl decanoate;6,6-dimethylheptyl 4,4-dioctoxybutanoate;(6Z,9Z)-19,19-dimethylicosa-6,9-diene |
|---|---|
| PubChem CID | 158773446 |
| Molecular Formula | C73H144O6 |
| Molecular Weight | 1117.95 g/mol |
| Exact Mass | 1117.10 |
| IUPAC Name | 9,9-dimethyldecyl decanoate;6,6-dimethylheptyl 4,4-dioctoxybutanoate;(6Z,9Z)-19,19-dimethylicosa-6,9-diene |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCC(C)(C)C.CCCCCCCCCC(=O)OCCCCCCCCC(C)(C)C.CCCCCCCCOC(CCC(=O)OCCCCCC(C)(C)C)OCCCCCCCC |
| InChI | InChI=1S/C29H58O4.C22H44O2.C22H42/c1-6-8-10-12-14-18-25-32-28(33-26-19-15-13-11-9-7-2)22-21-27(30)31-24-20-16-17-23-29(3,4)5;1-5-6-7-8-9-12-15-18-21(23)24-20-17-14-11-10-13-16-19-22(2,3)4;1-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22(2,3)4/h28H,6-26H2,1-5H3;5-20H2,1-4H3;9-10,12-13H,5-8,11,14-21H2,1-4H3/b;;10-9-,13-12- |
| InChIKey | IQDZHHBEINULMR-OELBNYMASA-N |
| XLogP | 24.68 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 54 |
| Heavy Atoms | 79 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1117.95 |
| LogP ≤ 5 | 24.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|