C42H79NO7 — CID 162764272
[2-(4,4-dioctoxybutanoyloxymethyl)-3-(hydroxyamino)propyl] (9Z,12Z)-octadeca-9,12-dienoate (PubChem CID 162764272) has the molecular formula C42H79NO7 and a molecular weight of 710.09 g/mol. Its IUPAC name is [2-(4,4-dioctoxybutanoyloxymethyl)-3-(hydroxyamino)propyl] (9Z,12Z)-octadeca-9,12-dienoate.
| Compound Name | [2-(4,4-dioctoxybutanoyloxymethyl)-3-(hydroxyamino)propyl] (9Z,12Z)-octadeca-9,12-dienoate |
|---|---|
| PubChem CID | 162764272 |
| Molecular Formula | C42H79NO7 |
| Molecular Weight | 710.09 g/mol |
| Exact Mass | 709.59 |
| IUPAC Name | [2-(4,4-dioctoxybutanoyloxymethyl)-3-(hydroxyamino)propyl] (9Z,12Z)-octadeca-9,12-dienoate |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCC(=O)OCC(CNO)COC(=O)CCC(OCCCCCCCC)OCCCCCCCC |
| InChI | InChI=1S/C42H79NO7/c1-4-7-10-13-16-17-18-19-20-21-22-23-24-25-28-31-40(44)49-37-39(36-43-46)38-50-41(45)32-33-42(47-34-29-26-14-11-8-5-2)48-35-30-27-15-12-9-6-3/h16-17,19-20,39,42-43,46H,4-15,18,21-38H2,1-3H3/b17-16-,20-19- |
| InChIKey | KJTAWTWAVVIGGF-LTXDKZCQSA-N |
| XLogP | 11.34 |
| TPSA | 103.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 39 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 710.09 |
| LogP ≤ 5 | 11.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|