C48H88N2O8 — CID 170917994
[2-[2-(azetidin-1-yl)ethylcarbamoyloxymethyl]-3-(4,4-dioctoxybutanoyloxy)propyl] (9Z,12Z)-octadeca-9,12-dienoate (PubChem CID 170917994) has the molecular formula C48H88N2O8 and a molecular weight of 821.24 g/mol. Its IUPAC name is [2-[2-(azetidin-1-yl)ethylcarbamoyloxymethyl]-3-(4,4-dioctoxybutanoyloxy)propyl] (9Z,12Z)-octadeca-9,12-dienoate.
| Compound Name | [2-[2-(azetidin-1-yl)ethylcarbamoyloxymethyl]-3-(4,4-dioctoxybutanoyloxy)propyl] (9Z,12Z)-octadeca-9,12-dienoate |
|---|---|
| PubChem CID | 170917994 |
| Molecular Formula | C48H88N2O8 |
| Molecular Weight | 821.24 g/mol |
| Exact Mass | 820.65 |
| IUPAC Name | [2-[2-(azetidin-1-yl)ethylcarbamoyloxymethyl]-3-(4,4-dioctoxybutanoyloxy)propyl] (9Z,12Z)-octadeca-9,12-dienoate |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCC(=O)OCC(COC(=O)CCC(OCCCCCCCC)OCCCCCCCC)COC(=O)NCCN1CCC1 |
| InChI | InChI=1S/C48H88N2O8/c1-4-7-10-13-16-17-18-19-20-21-22-23-24-25-28-32-45(51)56-41-44(43-58-48(53)49-35-38-50-36-31-37-50)42-57-46(52)33-34-47(54-39-29-26-14-11-8-5-2)55-40-30-27-15-12-9-6-3/h16-17,19-20,44,47H,4-15,18,21-43H2,1-3H3,(H,49,53)/b17-16-,20-19- |
| InChIKey | FJPIGEJTHUBIBM-LTXDKZCQSA-N |
| XLogP | 11.79 |
| TPSA | 112.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 42 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 821.24 |
| LogP ≤ 5 | 11.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|