C41H74N2O8 — CID 174175102
[3-[4,4-bis[(Z)-oct-5-enoxy]butanoyloxy]-2-methylpropyl] 4-(2-pyrrolidin-1-ylethylcarbamoyloxy)decanoate (PubChem CID 174175102) has the molecular formula C41H74N2O8 and a molecular weight of 723.05 g/mol. Its IUPAC name is [3-[4,4-bis[(Z)-oct-5-enoxy]butanoyloxy]-2-methylpropyl] 4-(2-pyrrolidin-1-ylethylcarbamoyloxy)decanoate.
| Compound Name | [3-[4,4-bis[(Z)-oct-5-enoxy]butanoyloxy]-2-methylpropyl] 4-(2-pyrrolidin-1-ylethylcarbamoyloxy)decanoate |
|---|---|
| PubChem CID | 174175102 |
| Molecular Formula | C41H74N2O8 |
| Molecular Weight | 723.05 g/mol |
| Exact Mass | 722.54 |
| IUPAC Name | [3-[4,4-bis[(Z)-oct-5-enoxy]butanoyloxy]-2-methylpropyl] 4-(2-pyrrolidin-1-ylethylcarbamoyloxy)decanoate |
| SMILES | CC/C=C\CCCCOC(CCC(=O)OCC(C)COC(=O)CCC(CCCCCC)OC(=O)NCCN1CCCC1)OCCCC/C=C\CC |
| InChI | InChI=1S/C41H74N2O8/c1-5-8-11-14-16-21-32-47-40(48-33-22-17-15-12-9-6-2)27-26-39(45)50-35-36(4)34-49-38(44)25-24-37(23-18-13-10-7-3)51-41(46)42-28-31-43-29-19-20-30-43/h8-9,11-12,36-37,40H,5-7,10,13-35H2,1-4H3,(H,42,46)/b11-8-,12-9- |
| InChIKey | RTPNZYRYWXTLQA-QAHSQZNUSA-N |
| XLogP | 9.06 |
| TPSA | 112.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 33 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 723.05 |
| LogP ≤ 5 | 9.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|