C61H110N2O12 — CID 170736395
7-O-[2-[4,4-bis[(Z)-oct-5-enoxy]butanoyloxymethyl]-3-[4-(2-pyrrolidin-1-ylethylcarbamoyloxy)decanoyloxy]propyl] 1-O-(3-pentyloctyl) heptanedioate (PubChem CID 170736395) has the molecular formula C61H110N2O12 and a molecular weight of 1063.55 g/mol. Its IUPAC name is 7-O-[2-[4,4-bis[(Z)-oct-5-enoxy]butanoyloxymethyl]-3-[4-(2-pyrrolidin-1-ylethylcarbamoyloxy)decanoyloxy]propyl] 1-O-(3-pentyloctyl) heptanedioate.
| Compound Name | 7-O-[2-[4,4-bis[(Z)-oct-5-enoxy]butanoyloxymethyl]-3-[4-(2-pyrrolidin-1-ylethylcarbamoyloxy)decanoyloxy]propyl] 1-O-(3-pentyloctyl) heptanedioate |
|---|---|
| PubChem CID | 170736395 |
| Molecular Formula | C61H110N2O12 |
| Molecular Weight | 1063.55 g/mol |
| Exact Mass | 1062.81 |
| IUPAC Name | 7-O-[2-[4,4-bis[(Z)-oct-5-enoxy]butanoyloxymethyl]-3-[4-(2-pyrrolidin-1-ylethylcarbamoyloxy)decanoyloxy]propyl] 1-O-(3-pentyloctyl) heptanedioate |
| SMILES | CC/C=C\CCCCOC(CCC(=O)OCC(COC(=O)CCCCCC(=O)OCCC(CCCCC)CCCCC)COC(=O)CCC(CCCCCC)OC(=O)NCCN1CCCC1)OCCCC/C=C\CC |
| InChI | InChI=1S/C61H110N2O12/c1-6-11-16-19-21-31-47-70-60(71-48-32-22-20-17-12-7-2)41-40-59(67)74-52-54(50-72-57(65)37-28-23-27-36-56(64)69-49-42-53(33-24-14-9-4)34-25-15-10-5)51-73-58(66)39-38-55(35-26-18-13-8-3)75-61(68)62-43-46-63-44-29-30-45-63/h11-12,16-17,53-55,60H,6-10,13-15,18-52H2,1-5H3,(H,62,68)/b16-11-,17-12- |
| InChIKey | XLAWSTVIGVXILK-LSQIQBGYSA-N |
| XLogP | 14.25 |
| TPSA | 165.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 52 |
| Heavy Atoms | 75 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1063.55 |
| LogP ≤ 5 | 14.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|