C68H120N2O12 — CID 164591054
1-O-[[3-(4,4-dioctoxybutanoyloxymethyl)-5-[4-(2-pyrrolidin-1-ylethylcarbamoyloxy)decanoyloxymethyl]phenyl]methyl] 6-O-(2-hexyldecyl) hexanedioate (PubChem CID 164591054) has the molecular formula C68H120N2O12 and a molecular weight of 1157.71 g/mol. Its IUPAC name is 1-O-[[3-(4,4-dioctoxybutanoyloxymethyl)-5-[4-(2-pyrrolidin-1-ylethylcarbamoyloxy)decanoyloxymethyl]phenyl]methyl] 6-O-(2-hexyldecyl) hexanedioate.
| Compound Name | 1-O-[[3-(4,4-dioctoxybutanoyloxymethyl)-5-[4-(2-pyrrolidin-1-ylethylcarbamoyloxy)decanoyloxymethyl]phenyl]methyl] 6-O-(2-hexyldecyl) hexanedioate |
|---|---|
| PubChem CID | 164591054 |
| Molecular Formula | C68H120N2O12 |
| Molecular Weight | 1157.71 g/mol |
| Exact Mass | 1156.88 |
| IUPAC Name | 1-O-[[3-(4,4-dioctoxybutanoyloxymethyl)-5-[4-(2-pyrrolidin-1-ylethylcarbamoyloxy)decanoyloxymethyl]phenyl]methyl] 6-O-(2-hexyldecyl) hexanedioate |
| SMILES | CCCCCCCCOC(CCC(=O)OCc1cc(COC(=O)CCCCC(=O)OCC(CCCCCC)CCCCCCCC)cc(COC(=O)CCC(CCCCCC)OC(=O)NCCN2CCCC2)c1)OCCCCCCCC |
| InChI | InChI=1S/C68H120N2O12/c1-6-11-16-21-24-28-37-58(36-27-19-14-9-4)54-78-63(71)39-30-31-40-64(72)79-55-59-51-60(56-80-65(73)42-41-62(38-29-20-15-10-5)82-68(75)69-45-48-70-46-32-33-47-70)53-61(52-59)57-81-66(74)43-44-67(76-49-34-25-22-17-12-7-2)77-50-35-26-23-18-13-8-3/h51-53,58,62,67H,6-50,54-57H2,1-5H3,(H,69,75) |
| InChIKey | GTQJVVHHHQZYIB-UHFFFAOYSA-N |
| XLogP | 17.06 |
| TPSA | 165.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 56 |
| Heavy Atoms | 82 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1157.71 |
| LogP ≤ 5 | 17.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|