C66H116N2O12 — CID 164591155
7-O-[[3-(4,4-dioctoxybutanoyloxymethyl)-5-[4-(2-pyrrolidin-1-ylethylcarbamoyloxy)decanoyloxymethyl]phenyl]methyl] 1-O-(3-pentyloctyl) heptanedioate (PubChem CID 164591155) has the molecular formula C66H116N2O12 and a molecular weight of 1129.66 g/mol. Its IUPAC name is 7-O-[[3-(4,4-dioctoxybutanoyloxymethyl)-5-[4-(2-pyrrolidin-1-ylethylcarbamoyloxy)decanoyloxymethyl]phenyl]methyl] 1-O-(3-pentyloctyl) heptanedioate.
| Compound Name | 7-O-[[3-(4,4-dioctoxybutanoyloxymethyl)-5-[4-(2-pyrrolidin-1-ylethylcarbamoyloxy)decanoyloxymethyl]phenyl]methyl] 1-O-(3-pentyloctyl) heptanedioate |
|---|---|
| PubChem CID | 164591155 |
| Molecular Formula | C66H116N2O12 |
| Molecular Weight | 1129.66 g/mol |
| Exact Mass | 1128.85 |
| IUPAC Name | 7-O-[[3-(4,4-dioctoxybutanoyloxymethyl)-5-[4-(2-pyrrolidin-1-ylethylcarbamoyloxy)decanoyloxymethyl]phenyl]methyl] 1-O-(3-pentyloctyl) heptanedioate |
| SMILES | CCCCCCCCOC(CCC(=O)OCc1cc(COC(=O)CCCCCC(=O)OCCC(CCCCC)CCCCC)cc(COC(=O)CCC(CCCCCC)OC(=O)NCCN2CCCC2)c1)OCCCCCCCC |
| InChI | InChI=1S/C66H116N2O12/c1-6-11-16-19-21-31-47-75-65(76-48-32-22-20-17-12-7-2)41-40-64(72)79-55-59-51-57(53-77-62(70)37-28-23-27-36-61(69)74-49-42-56(33-24-14-9-4)34-25-15-10-5)50-58(52-59)54-78-63(71)39-38-60(35-26-18-13-8-3)80-66(73)67-43-46-68-44-29-30-45-68/h50-52,56,60,65H,6-49,53-55H2,1-5H3,(H,67,73) |
| InChIKey | UKDXADXCBVYBRL-UHFFFAOYSA-N |
| XLogP | 16.28 |
| TPSA | 165.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 54 |
| Heavy Atoms | 80 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1129.66 |
| LogP ≤ 5 | 16.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|