C56H84N2O10 — CID 164591367
[3-[4,4-bis(oct-3-ynoxy)butanoyloxymethyl]-5-(2-pyrrolidin-1-ylethylcarbamoyloxymethyl)phenyl]methyl 4,4-bis(oct-3-ynoxy)butanoate (PubChem CID 164591367) has the molecular formula C56H84N2O10 and a molecular weight of 945.29 g/mol. Its IUPAC name is [3-[4,4-bis(oct-3-ynoxy)butanoyloxymethyl]-5-(2-pyrrolidin-1-ylethylcarbamoyloxymethyl)phenyl]methyl 4,4-bis(oct-3-ynoxy)butanoate.
| Compound Name | [3-[4,4-bis(oct-3-ynoxy)butanoyloxymethyl]-5-(2-pyrrolidin-1-ylethylcarbamoyloxymethyl)phenyl]methyl 4,4-bis(oct-3-ynoxy)butanoate |
|---|---|
| PubChem CID | 164591367 |
| Molecular Formula | C56H84N2O10 |
| Molecular Weight | 945.29 g/mol |
| Exact Mass | 944.61 |
| IUPAC Name | [3-[4,4-bis(oct-3-ynoxy)butanoyloxymethyl]-5-(2-pyrrolidin-1-ylethylcarbamoyloxymethyl)phenyl]methyl 4,4-bis(oct-3-ynoxy)butanoate |
| SMILES | CCCCC#CCCOC(CCC(=O)OCc1cc(COC(=O)CCC(OCCC#CCCCC)OCCC#CCCCC)cc(COC(=O)NCCN2CCCC2)c1)OCCC#CCCCC |
| InChI | InChI=1S/C56H84N2O10/c1-5-9-13-17-21-27-39-62-54(63-40-28-22-18-14-10-6-2)33-31-52(59)66-46-49-43-50(45-51(44-49)48-68-56(61)57-35-38-58-36-25-26-37-58)47-67-53(60)32-34-55(64-41-29-23-19-15-11-7-3)65-42-30-24-20-16-12-8-4/h43-45,54-55H,5-16,25-42,46-48H2,1-4H3,(H,57,61) |
| InChIKey | SRBZFMBVBQJMKY-UHFFFAOYSA-N |
| XLogP | 10.71 |
| TPSA | 131.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 35 |
| Heavy Atoms | 68 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 945.29 |
| LogP ≤ 5 | 10.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|