C54H88N2O8 — CID 164591316
[3-[4,4-bis[(Z)-oct-5-enoxy]butanoyloxymethyl]-5-(2-pyrrolidin-1-ylethylcarbamoyloxymethyl)phenyl]methyl (9Z,12Z)-octadeca-9,12-dienoate (PubChem CID 164591316) has the molecular formula C54H88N2O8 and a molecular weight of 893.30 g/mol. Its IUPAC name is [3-[4,4-bis[(Z)-oct-5-enoxy]butanoyloxymethyl]-5-(2-pyrrolidin-1-ylethylcarbamoyloxymethyl)phenyl]methyl (9Z,12Z)-octadeca-9,12-dienoate.
| Compound Name | [3-[4,4-bis[(Z)-oct-5-enoxy]butanoyloxymethyl]-5-(2-pyrrolidin-1-ylethylcarbamoyloxymethyl)phenyl]methyl (9Z,12Z)-octadeca-9,12-dienoate |
|---|---|
| PubChem CID | 164591316 |
| Molecular Formula | C54H88N2O8 |
| Molecular Weight | 893.30 g/mol |
| Exact Mass | 892.65 |
| IUPAC Name | [3-[4,4-bis[(Z)-oct-5-enoxy]butanoyloxymethyl]-5-(2-pyrrolidin-1-ylethylcarbamoyloxymethyl)phenyl]methyl (9Z,12Z)-octadeca-9,12-dienoate |
| SMILES | CC/C=C\CCCCOC(CCC(=O)OCc1cc(COC(=O)CCCCCCC/C=C\C/C=C\CCCCC)cc(COC(=O)NCCN2CCCC2)c1)OCCCC/C=C\CC |
| InChI | InChI=1S/C54H88N2O8/c1-4-7-10-13-16-17-18-19-20-21-22-23-24-25-28-33-51(57)62-45-48-42-49(44-50(43-48)47-64-54(59)55-36-39-56-37-29-30-38-56)46-63-52(58)34-35-53(60-40-31-26-14-11-8-5-2)61-41-32-27-15-12-9-6-3/h8-9,11-12,16-17,19-20,42-44,53H,4-7,10,13-15,18,21-41,45-47H2,1-3H3,(H,55,59)/b11-8-,12-9-,17-16-,20-19- |
| InChIKey | YQGMWWZUSJRTAY-QBXBLZHRSA-N |
| XLogP | 13.32 |
| TPSA | 112.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 40 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 893.30 |
| LogP ≤ 5 | 13.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|