C45H83NO6 — CID 123852655
non-2-enyl 9-[1-(9-non-2-enoxy-9-oxononoxy)-5-pyrrolidin-1-ylpentoxy]nonanoate (PubChem CID 123852655) has the molecular formula C45H83NO6 and a molecular weight of 734.16 g/mol. Its IUPAC name is non-2-enyl 9-[1-(9-non-2-enoxy-9-oxononoxy)-5-pyrrolidin-1-ylpentoxy]nonanoate.
| Compound Name | non-2-enyl 9-[1-(9-non-2-enoxy-9-oxononoxy)-5-pyrrolidin-1-ylpentoxy]nonanoate |
|---|---|
| PubChem CID | 123852655 |
| Molecular Formula | C45H83NO6 |
| Molecular Weight | 734.16 g/mol |
| Exact Mass | 733.62 |
| IUPAC Name | non-2-enyl 9-[1-(9-non-2-enoxy-9-oxononoxy)-5-pyrrolidin-1-ylpentoxy]nonanoate |
| SMILES | CCCCCCC=CCOC(=O)CCCCCCCCOC(CCCCN1CCCC1)OCCCCCCCCC(=O)OCC=CCCCCCC |
| InChI | InChI=1S/C45H83NO6/c1-3-5-7-9-13-19-29-39-49-43(47)33-23-17-11-15-21-31-41-51-45(35-25-26-36-46-37-27-28-38-46)52-42-32-22-16-12-18-24-34-44(48)50-40-30-20-14-10-8-6-4-2/h19-20,29-30,45H,3-18,21-28,31-42H2,1-2H3 |
| InChIKey | FKENEMTUWYMGQQ-UHFFFAOYSA-N |
| XLogP | 12.21 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 39 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 734.16 |
| LogP ≤ 5 | 12.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|