C47H85NO2 — CID 172949810
[(6Z,9Z,28Z,31Z)-heptatriaconta-6,9,28,31-tetraen-19-yl] 5-piperidin-1-ylpentanoate (PubChem CID 172949810) has the molecular formula C47H85NO2 and a molecular weight of 696.20 g/mol. Its IUPAC name is [(6Z,9Z,28Z,31Z)-heptatriaconta-6,9,28,31-tetraen-19-yl] 5-piperidin-1-ylpentanoate.
| Compound Name | [(6Z,9Z,28Z,31Z)-heptatriaconta-6,9,28,31-tetraen-19-yl] 5-piperidin-1-ylpentanoate |
|---|---|
| PubChem CID | 172949810 |
| Molecular Formula | C47H85NO2 |
| Molecular Weight | 696.20 g/mol |
| Exact Mass | 695.66 |
| IUPAC Name | [(6Z,9Z,28Z,31Z)-heptatriaconta-6,9,28,31-tetraen-19-yl] 5-piperidin-1-ylpentanoate |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCC(CCCCCCCC/C=C\C/C=C\CCCCC)OC(=O)CCCCN1CCCCC1 |
| InChI | InChI=1S/C47H85NO2/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-31-34-40-46(50-47(49)42-36-39-45-48-43-37-33-38-44-48)41-35-32-30-28-26-24-22-20-18-16-14-12-10-8-6-4-2/h11-14,17-20,46H,3-10,15-16,21-45H2,1-2H3/b13-11-,14-12-,19-17-,20-18- |
| InChIKey | ZAPKDZCDOLFTMY-MAZCIEHSSA-N |
| XLogP | 14.96 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 36 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 696.20 |
| LogP ≤ 5 | 14.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|