C52H91NO8 — CID 160731846
[2-[4,4-bis(3-cyclohexylpropoxy)butanoyloxymethyl]-3-(4-pyrrolidin-1-ylbutanoyloxy)propyl] (9Z,12Z)-octadeca-9,12-dienoate (PubChem CID 160731846) has the molecular formula C52H91NO8 and a molecular weight of 858.30 g/mol. Its IUPAC name is [2-[4,4-bis(3-cyclohexylpropoxy)butanoyloxymethyl]-3-(4-pyrrolidin-1-ylbutanoyloxy)propyl] (9Z,12Z)-octadeca-9,12-dienoate.
| Compound Name | [2-[4,4-bis(3-cyclohexylpropoxy)butanoyloxymethyl]-3-(4-pyrrolidin-1-ylbutanoyloxy)propyl] (9Z,12Z)-octadeca-9,12-dienoate |
|---|---|
| PubChem CID | 160731846 |
| Molecular Formula | C52H91NO8 |
| Molecular Weight | 858.30 g/mol |
| Exact Mass | 857.67 |
| IUPAC Name | [2-[4,4-bis(3-cyclohexylpropoxy)butanoyloxymethyl]-3-(4-pyrrolidin-1-ylbutanoyloxy)propyl] (9Z,12Z)-octadeca-9,12-dienoate |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCC(=O)OCC(COC(=O)CCCN1CCCC1)COC(=O)CCC(OCCCC1CCCCC1)OCCCC1CCCCC1 |
| InChI | InChI=1S/C52H91NO8/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-22-34-49(54)59-43-48(44-60-50(55)35-25-40-53-38-23-24-39-53)45-61-51(56)36-37-52(57-41-26-32-46-28-18-16-19-29-46)58-42-27-33-47-30-20-17-21-31-47/h6-7,9-10,46-48,52H,2-5,8,11-45H2,1H3/b7-6-,10-9- |
| InChIKey | RULHBNVFENENQJ-HZJYTTRNSA-N |
| XLogP | 12.78 |
| TPSA | 100.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 37 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 858.30 |
| LogP ≤ 5 | 12.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|