C52H93NO8 — CID 118178607
[2-(4,4-dioctoxybutanoyloxymethyl)-3-[(9Z,12Z)-octadeca-9,12-dienoyl]oxypropyl] 1-(cyclopropylmethyl)piperidine-4-carboxylate (PubChem CID 118178607) has the molecular formula C52H93NO8 and a molecular weight of 860.31 g/mol. Its IUPAC name is [2-(4,4-dioctoxybutanoyloxymethyl)-3-[(9Z,12Z)-octadeca-9,12-dienoyl]oxypropyl] 1-(cyclopropylmethyl)piperidine-4-carboxylate.
| Compound Name | [2-(4,4-dioctoxybutanoyloxymethyl)-3-[(9Z,12Z)-octadeca-9,12-dienoyl]oxypropyl] 1-(cyclopropylmethyl)piperidine-4-carboxylate |
|---|---|
| PubChem CID | 118178607 |
| Molecular Formula | C52H93NO8 |
| Molecular Weight | 860.31 g/mol |
| Exact Mass | 859.69 |
| IUPAC Name | [2-(4,4-dioctoxybutanoyloxymethyl)-3-[(9Z,12Z)-octadeca-9,12-dienoyl]oxypropyl] 1-(cyclopropylmethyl)piperidine-4-carboxylate |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCC(=O)OCC(COC(=O)CCC(OCCCCCCCC)OCCCCCCCC)COC(=O)C1CCN(CC2CC2)CC1 |
| InChI | InChI=1S/C52H93NO8/c1-4-7-10-13-16-17-18-19-20-21-22-23-24-25-28-31-49(54)59-43-47(45-61-52(56)48-36-38-53(39-37-48)42-46-32-33-46)44-60-50(55)34-35-51(57-40-29-26-14-11-8-5-2)58-41-30-27-15-12-9-6-3/h16-17,19-20,46-48,51H,4-15,18,21-45H2,1-3H3/b17-16-,20-19- |
| InChIKey | LONCKTKDFANUSG-LTXDKZCQSA-N |
| XLogP | 13.03 |
| TPSA | 100.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 42 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 860.31 |
| LogP ≤ 5 | 13.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|