C48H80N2O6 — CID 176584135
[2-[[2-(1-adamantyl)acetyl]oxymethyl]-3-[(10Z,13Z)-nonadeca-10,13-dienoyl]oxypropyl] 1-(1-ethylpiperidin-4-yl)piperidine-4-carboxylate (PubChem CID 176584135) has the molecular formula C48H80N2O6 and a molecular weight of 781.18 g/mol. Its IUPAC name is [2-[[2-(1-adamantyl)acetyl]oxymethyl]-3-[(10Z,13Z)-nonadeca-10,13-dienoyl]oxypropyl] 1-(1-ethylpiperidin-4-yl)piperidine-4-carboxylate.
| Compound Name | [2-[[2-(1-adamantyl)acetyl]oxymethyl]-3-[(10Z,13Z)-nonadeca-10,13-dienoyl]oxypropyl] 1-(1-ethylpiperidin-4-yl)piperidine-4-carboxylate |
|---|---|
| PubChem CID | 176584135 |
| Molecular Formula | C48H80N2O6 |
| Molecular Weight | 781.18 g/mol |
| Exact Mass | 780.60 |
| IUPAC Name | [2-[[2-(1-adamantyl)acetyl]oxymethyl]-3-[(10Z,13Z)-nonadeca-10,13-dienoyl]oxypropyl] 1-(1-ethylpiperidin-4-yl)piperidine-4-carboxylate |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCC(=O)OCC(COC(=O)CC12CC3CC(CC(C3)C1)C2)COC(=O)C1CCN(C2CCN(CC)CC2)CC1 |
| InChI | InChI=1S/C48H80N2O6/c1-3-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-45(51)54-36-42(37-55-46(52)35-48-32-39-29-40(33-48)31-41(30-39)34-48)38-56-47(53)43-21-27-50(28-22-43)44-23-25-49(4-2)26-24-44/h8-9,11-12,39-44H,3-7,10,13-38H2,1-2H3/b9-8-,12-11- |
| InChIKey | SQQONEWWJYCYTD-MURFETPASA-N |
| XLogP | 10.24 |
| TPSA | 85.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 781.18 |
| LogP ≤ 5 | 10.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|