C50H87NO6 — CID 166716176
[2-[[(9Z,12Z)-1-hydroxyoctadeca-9,12-dienoxy]methyl]-3-[(9Z,12Z)-octadeca-9,12-dienoyl]oxypropyl] 1-(cyclopropylmethyl)piperidine-4-carboxylate (PubChem CID 166716176) has the molecular formula C50H87NO6 and a molecular weight of 798.25 g/mol. Its IUPAC name is [2-[[(9Z,12Z)-1-hydroxyoctadeca-9,12-dienoxy]methyl]-3-[(9Z,12Z)-octadeca-9,12-dienoyl]oxypropyl] 1-(cyclopropylmethyl)piperidine-4-carboxylate.
| Compound Name | [2-[[(9Z,12Z)-1-hydroxyoctadeca-9,12-dienoxy]methyl]-3-[(9Z,12Z)-octadeca-9,12-dienoyl]oxypropyl] 1-(cyclopropylmethyl)piperidine-4-carboxylate |
|---|---|
| PubChem CID | 166716176 |
| Molecular Formula | C50H87NO6 |
| Molecular Weight | 798.25 g/mol |
| Exact Mass | 797.65 |
| IUPAC Name | [2-[[(9Z,12Z)-1-hydroxyoctadeca-9,12-dienoxy]methyl]-3-[(9Z,12Z)-octadeca-9,12-dienoyl]oxypropyl] 1-(cyclopropylmethyl)piperidine-4-carboxylate |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCC(=O)OCC(COC(=O)C1CCN(CC2CC2)CC1)COC(O)CCCCCCC/C=C\C/C=C\CCCCC |
| InChI | InChI=1S/C50H87NO6/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-48(52)55-42-46(44-57-50(54)47-37-39-51(40-38-47)41-45-35-36-45)43-56-49(53)34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-4-2/h11-14,17-20,45-48,52H,3-10,15-16,21-44H2,1-2H3/b13-11-,14-12-,19-17-,20-18- |
| InChIKey | HTEURPFXEHTBGD-MAZCIEHSSA-N |
| XLogP | 12.77 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 38 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 798.25 |
| LogP ≤ 5 | 12.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|